C16H20O5 — CID 10637375
dimethyl (1R,4S)-1-(4-methylpent-3-enyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 10637375) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is dimethyl (1R,4S)-1-(4-methylpent-3-enyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,4S)-1-(4-methylpent-3-enyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10637375 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | dimethyl (1R,4S)-1-(4-methylpent-3-enyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(CCC=C(C)C)C=C[C@@H]1O2 |
| InChI | InChI=1S/C16H20O5/c1-10(2)6-5-8-16-9-7-11(21-16)12(14(17)19-3)13(16)15(18)20-4/h6-7,9,11H,5,8H2,1-4H3/t11-,16+/m0/s1 |
| InChIKey | BVNOHCKXYAOHTN-MEDUHNTESA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|