C12H17N5O3 — CID 106373800
1-methyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-4-nitro-3-propan-2-ylpyrazol-5-amine (PubChem CID 106373800) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-methyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-4-nitro-3-propan-2-ylpyrazol-5-amine.
| Compound Name | 1-methyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-4-nitro-3-propan-2-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 106373800 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-methyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-4-nitro-3-propan-2-ylpyrazol-5-amine |
| SMILES | Cc1cnc(CNc2c([N+](=O)[O-])c(C(C)C)nn2C)o1 |
| InChI | InChI=1S/C12H17N5O3/c1-7(2)10-11(17(18)19)12(16(4)15-10)14-6-9-13-5-8(3)20-9/h5,7,14H,6H2,1-4H3 |
| InChIKey | YROQJAYRLYUQFX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|