About 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one
2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one (PubChem CID 10637400) has the molecular formula C20H20O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one |
| PubChem CID | 10637400 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one |
| SMILES | CC(C)=Cc1cc(C)c2ccc(C)c3c2c1C(C)=C(O)C3=O |
| InChI | InChI=1S/C20H20O2/c1-10(2)8-14-9-12(4)15-7-6-11(3)16-18(15)17(14)13(5)19(21)20(16)22/h6-9,21H,1-5H3 |
| InChIKey | QPEDAMHNYYMCLK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one?
The IUPAC name of 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one (CID 10637400) is 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one.
What is the SMILES notation for 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one?
The canonical SMILES for 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one is CC(C)=Cc1cc(C)c2ccc(C)c3c2c1C(C)=C(O)C3=O.
What is the InChIKey of 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one?
The InChIKey is QPEDAMHNYYMCLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O2/c1-10(2)8-14-9-12(4)15-7-6-11(3)16-18(15)17(14)13(5)19(21)20(16)22/h6-9,21H,1-5H3.
What are the key properties of 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one?
2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one has a molecular weight of 292.38 g/mol, XLogP of 5.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)phenalen-1-one is sourced from PubChem (CID 10637400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).