C12H19N3O4 — CID 106374501
3-[(5-methyl-1,3-oxazol-2-yl)methylcarbamoylamino]hexanoic acid (PubChem CID 106374501) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[(5-methyl-1,3-oxazol-2-yl)methylcarbamoylamino]hexanoic acid.
| Compound Name | 3-[(5-methyl-1,3-oxazol-2-yl)methylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 106374501 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-[(5-methyl-1,3-oxazol-2-yl)methylcarbamoylamino]hexanoic acid |
| SMILES | CCCC(CC(=O)O)NC(=O)NCc1ncc(C)o1 |
| InChI | InChI=1S/C12H19N3O4/c1-3-4-9(5-11(16)17)15-12(18)14-7-10-13-6-8(2)19-10/h6,9H,3-5,7H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | YOYLFMMAEHZIKL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |