C13H13ClN4O — CID 106375000
7-chloro-1-[(5-ethyl-1,3-oxazol-2-yl)methyl]benzimidazol-2-amine (PubChem CID 106375000) has the molecular formula C13H13ClN4O and a molecular weight of 276.73 g/mol. Its IUPAC name is 7-chloro-1-[(5-ethyl-1,3-oxazol-2-yl)methyl]benzimidazol-2-amine.
| Compound Name | 7-chloro-1-[(5-ethyl-1,3-oxazol-2-yl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 106375000 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 7-chloro-1-[(5-ethyl-1,3-oxazol-2-yl)methyl]benzimidazol-2-amine |
| SMILES | CCc1cnc(Cn2c(N)nc3cccc(Cl)c32)o1 |
| InChI | InChI=1S/C13H13ClN4O/c1-2-8-6-16-11(19-8)7-18-12-9(14)4-3-5-10(12)17-13(18)15/h3-6H,2,7H2,1H3,(H2,15,17) |
| InChIKey | WPOHLBYCZIRGMH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |