C14H13ClFN3O — CID 106375964
2-[[2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]-4,5-dimethyl-1,3-oxazole (PubChem CID 106375964) has the molecular formula C14H13ClFN3O and a molecular weight of 293.73 g/mol. Its IUPAC name is 2-[[2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]-4,5-dimethyl-1,3-oxazole.
| Compound Name | 2-[[2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]-4,5-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 106375964 |
| Molecular Formula | C14H13ClFN3O |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[[2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]-4,5-dimethyl-1,3-oxazole |
| SMILES | Cc1nc(Cn2c(CCl)nc3ccc(F)cc32)oc1C |
| InChI | InChI=1S/C14H13ClFN3O/c1-8-9(2)20-14(17-8)7-19-12-5-10(16)3-4-11(12)18-13(19)6-15/h3-5H,6-7H2,1-2H3 |
| InChIKey | OARCXUBKCKUPOZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|