C16H24O5 — CID 10637685
(4S,4'aS,5'R,8'aS)-5'-hydroxy-7'-(hydroxymethyl)-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one (PubChem CID 10637685) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (4S,4'aS,5'R,8'aS)-5'-hydroxy-7'-(hydroxymethyl)-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one.
| Compound Name | (4S,4'aS,5'R,8'aS)-5'-hydroxy-7'-(hydroxymethyl)-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one |
|---|---|
| PubChem CID | 10637685 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (4S,4'aS,5'R,8'aS)-5'-hydroxy-7'-(hydroxymethyl)-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1[C@H](O)C=C(CO)[C@]21COC(=O)O1 |
| InChI | InChI=1S/C16H24O5/c1-14(2)5-4-6-15(3)12(14)11(18)7-10(8-17)16(15)9-20-13(19)21-16/h7,11-12,17-18H,4-6,8-9H2,1-3H3/t11-,12+,15+,16-/m1/s1 |
| InChIKey | SDXHCPHOMLECQM-GUYJKWIASA-N |
| XLogP | 2.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|