C20H24O2 — CID 10637700
(1S,6S,8R,12S,13R)-12-hydroxy-7,7,14,14-tetramethylpentacyclo[11.1.1.16,8.02,11.05,10]hexadeca-2(11),3,5(10)-trien-9-one (PubChem CID 10637700) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1S,6S,8R,12S,13R)-12-hydroxy-7,7,14,14-tetramethylpentacyclo[11.1.1.16,8.02,11.05,10]hexadeca-2(11),3,5(10)-trien-9-one.
| Compound Name | (1S,6S,8R,12S,13R)-12-hydroxy-7,7,14,14-tetramethylpentacyclo[11.1.1.16,8.02,11.05,10]hexadeca-2(11),3,5(10)-trien-9-one |
|---|---|
| PubChem CID | 10637700 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (1S,6S,8R,12S,13R)-12-hydroxy-7,7,14,14-tetramethylpentacyclo[11.1.1.16,8.02,11.05,10]hexadeca-2(11),3,5(10)-trien-9-one |
| SMILES | CC1(C)[C@@H]2C[C@H]1C(=O)c1c2ccc2c1[C@@H](O)[C@@H]1C[C@H]2C1(C)C |
| InChI | InChI=1S/C20H24O2/c1-19(2)11-7-13(19)17(21)15-9(11)5-6-10-12-8-14(20(12,3)4)18(22)16(10)15/h5-6,11-14,17,21H,7-8H2,1-4H3/t11-,12-,13+,14+,17+/m1/s1 |
| InChIKey | KDUJQKCPUWCTQO-QDEPRCCBSA-N |
| XLogP | 4.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |