C15H20O2S2 — CID 10637706
(1'R,4'S,12'S)-4'-methylspiro[1,3-dithiane-2,9'-2-oxatricyclo[6.3.1.04,12]dodec-7-ene]-3'-one (PubChem CID 10637706) has the molecular formula C15H20O2S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (1'R,4'S,12'S)-4'-methylspiro[1,3-dithiane-2,9'-2-oxatricyclo[6.3.1.04,12]dodec-7-ene]-3'-one.
| Compound Name | (1'R,4'S,12'S)-4'-methylspiro[1,3-dithiane-2,9'-2-oxatricyclo[6.3.1.04,12]dodec-7-ene]-3'-one |
|---|---|
| PubChem CID | 10637706 |
| Molecular Formula | C15H20O2S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (1'R,4'S,12'S)-4'-methylspiro[1,3-dithiane-2,9'-2-oxatricyclo[6.3.1.04,12]dodec-7-ene]-3'-one |
| SMILES | C[C@]12CCC=C3[C@H]1[C@@H](CCC31SCCCS1)OC2=O |
| InChI | InChI=1S/C15H20O2S2/c1-14-6-2-4-10-12(14)11(17-13(14)16)5-7-15(10)18-8-3-9-19-15/h4,11-12H,2-3,5-9H2,1H3/t11-,12+,14+/m1/s1 |
| InChIKey | QTSMXMLQPXIIIG-DYEKYZERSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|