C16H32BNO3 — CID 10637726
(Z)-N-methoxy-4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octan-3-imine (PubChem CID 10637726) has the molecular formula C16H32BNO3 and a molecular weight of 297.25 g/mol. Its IUPAC name is (Z)-N-methoxy-4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octan-3-imine.
| Compound Name | (Z)-N-methoxy-4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octan-3-imine |
|---|---|
| PubChem CID | 10637726 |
| Molecular Formula | C16H32BNO3 |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (Z)-N-methoxy-4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octan-3-imine |
| SMILES | CCCCC(C)/C(CCB1OC(C)(C)C(C)(C)O1)=N\OC |
| InChI | InChI=1S/C16H32BNO3/c1-8-9-10-13(2)14(18-19-7)11-12-17-20-15(3,4)16(5,6)21-17/h13H,8-12H2,1-7H3/b18-14- |
| InChIKey | QZHZKCRFGOGXLH-JXAWBTAJSA-N |
| XLogP | 4.30 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|