About (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine
(1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine (PubChem CID 106377515) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine.
Molecular Properties
| Compound Name | (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine |
| PubChem CID | 106377515 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine |
| SMILES | CCc1cnc(Cn2cncc2[C@@H](C)N)o1 |
| InChI | InChI=1S/C11H16N4O/c1-3-9-4-14-11(16-9)6-15-7-13-5-10(15)8(2)12/h4-5,7-8H,3,6,12H2,1-2H3/t8-/m1/s1 |
| InChIKey | IRAQGQAPYOVPRB-MRVPVSSYSA-N |
| XLogP | 1.50 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine?
The IUPAC name of (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine (CID 106377515) is (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine.
What is the SMILES notation for (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine?
The canonical SMILES for (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine is CCc1cnc(Cn2cncc2[C@@H](C)N)o1.
What is the InChIKey of (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine?
The InChIKey is IRAQGQAPYOVPRB-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-3-9-4-14-11(16-9)6-15-7-13-5-10(15)8(2)12/h4-5,7-8H,3,6,12H2,1-2H3/t8-/m1/s1.
What are the key properties of (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine?
(1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine has a molecular weight of 220.28 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[3-[(5-ethyl-1,3-oxazol-2-yl)methyl]imidazol-4-yl]ethanamine is sourced from PubChem (CID 106377515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).