About 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole
2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole (PubChem CID 106377546) has the molecular formula C16H16N4O
and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole |
| PubChem CID | 106377546 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole |
| SMILES | Cc1cnc(Cn2cncc2-c2cccc3c2NCC3)o1 |
| InChI | InChI=1S/C16H16N4O/c1-11-7-19-15(21-11)9-20-10-17-8-14(20)13-4-2-3-12-5-6-18-16(12)13/h2-4,7-8,10,18H,5-6,9H2,1H3 |
| InChIKey | RXHDSXWHZSREMN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole?
The IUPAC name of 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole (CID 106377546) is 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole.
What is the SMILES notation for 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole?
The canonical SMILES for 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole is Cc1cnc(Cn2cncc2-c2cccc3c2NCC3)o1.
What is the InChIKey of 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole?
The InChIKey is RXHDSXWHZSREMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O/c1-11-7-19-15(21-11)9-20-10-17-8-14(20)13-4-2-3-12-5-6-18-16(12)13/h2-4,7-8,10,18H,5-6,9H2,1H3.
What are the key properties of 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole?
2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole has a molecular weight of 280.33 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]methyl]-5-methyl-1,3-oxazole is sourced from PubChem (CID 106377546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).