C18H18O4 — CID 10637803
(1R,13R)-13-tert-butyl-14,16-dioxatetracyclo[11.2.1.02,11.04,9]hexadeca-2(11),4,6,8-tetraene-3,10-dione (PubChem CID 10637803) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (1R,13R)-13-tert-butyl-14,16-dioxatetracyclo[11.2.1.02,11.04,9]hexadeca-2(11),4,6,8-tetraene-3,10-dione.
| Compound Name | (1R,13R)-13-tert-butyl-14,16-dioxatetracyclo[11.2.1.02,11.04,9]hexadeca-2(11),4,6,8-tetraene-3,10-dione |
|---|---|
| PubChem CID | 10637803 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1R,13R)-13-tert-butyl-14,16-dioxatetracyclo[11.2.1.02,11.04,9]hexadeca-2(11),4,6,8-tetraene-3,10-dione |
| SMILES | CC(C)(C)[C@]12CC3=C(C(=O)c4ccccc4C3=O)[C@H](CO1)O2 |
| InChI | InChI=1S/C18H18O4/c1-17(2,3)18-8-12-14(13(22-18)9-21-18)16(20)11-7-5-4-6-10(11)15(12)19/h4-7,13H,8-9H2,1-3H3/t13-,18+/m0/s1 |
| InChIKey | HZYJZCSFTBMMSH-SCLBCKFNSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|