About tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate
tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate (PubChem CID 10637894) has the molecular formula C13H21N3O3S
and a molecular weight of 299.40 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate |
| PubChem CID | 10637894 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)c1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C13H21N3O3S/c1-7(2)9(16-12(18)19-13(3,4)5)11-15-8(6-20-11)10(14)17/h6-7,9H,1-5H3,(H2,14,17)(H,16,18)/t9-/m0/s1 |
| InChIKey | QBNPNOQYDGGJKB-VIFPVBQESA-N |
| XLogP | 2.46 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate?
The IUPAC name of tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate (CID 10637894) is tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate?
The canonical SMILES for tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate is CC(C)[C@H](NC(=O)OC(C)(C)C)c1nc(C(N)=O)cs1.
What is the InChIKey of tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate?
The InChIKey is QBNPNOQYDGGJKB-VIFPVBQESA-N. The full InChI is InChI=1S/C13H21N3O3S/c1-7(2)9(16-12(18)19-13(3,4)5)11-15-8(6-20-11)10(14)17/h6-7,9H,1-5H3,(H2,14,17)(H,16,18)/t9-/m0/s1.
What are the key properties of tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate?
tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate has a molecular weight of 299.40 g/mol, XLogP of 2.46, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S)-1-(4-carbamoyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate is sourced from PubChem (CID 10637894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).