C10H12N2O4S — CID 106379548
2,3-dimethyl-4-oxo-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoic acid (PubChem CID 106379548) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-oxo-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106379548 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2,3-dimethyl-4-oxo-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H12N2O4S/c1-5(6(2)9(14)15)8(13)11-3-7-4-17-10(16)12-7/h4H,3H2,1-2H3,(H,11,13)(H,12,16)(H,14,15) |
| InChIKey | YHKKJZSVEYDTPN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|