About 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid
1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid (PubChem CID 106379561) has the molecular formula C10H15N3O5S2
and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid |
| PubChem CID | 106379561 |
| Molecular Formula | C10H15N3O5S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)NCc2csc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C10H15N3O5S2/c14-9(15)7-1-3-13(4-2-7)20(17,18)11-5-8-6-19-10(16)12-8/h6-7,11H,1-5H2,(H,12,16)(H,14,15) |
| InChIKey | QHUYQCRQYVSKQX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid (CID 106379561) is 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid is O=C(O)C1CCN(S(=O)(=O)NCc2csc(=O)[nH]2)CC1.
What is the InChIKey of 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid?
The InChIKey is QHUYQCRQYVSKQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O5S2/c14-9(15)7-1-3-13(4-2-7)20(17,18)11-5-8-6-19-10(16)12-8/h6-7,11H,1-5H2,(H,12,16)(H,14,15).
What are the key properties of 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid?
1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid has a molecular weight of 321.38 g/mol, XLogP of -0.43, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 106379561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).