About tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate
tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate (PubChem CID 106379617) has the molecular formula C12H21N3O3S
and a molecular weight of 287.38 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate |
| PubChem CID | 106379617 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C12H21N3O3S/c1-8(5-14-10(16)18-12(2,3)4)13-6-9-7-19-11(17)15-9/h7-8,13H,5-6H2,1-4H3,(H,14,16)(H,15,17) |
| InChIKey | QNMVWVCOJGNHIL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate?
The IUPAC name of tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate (CID 106379617) is tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate is CC(CNC(=O)OC(C)(C)C)NCc1csc(=O)[nH]1.
What is the InChIKey of tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate?
The InChIKey is QNMVWVCOJGNHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3S/c1-8(5-14-10(16)18-12(2,3)4)13-6-9-7-19-11(17)15-9/h7-8,13H,5-6H2,1-4H3,(H,14,16)(H,15,17).
What are the key properties of tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate?
tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate has a molecular weight of 287.38 g/mol, XLogP of 1.44, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propyl]carbamate is sourced from PubChem (CID 106379617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).