About 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one
4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379847) has the molecular formula C11H18N2OS2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 106379847 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC1(C)CCSCC1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H18N2OS2/c1-11(2)3-4-15-7-9(11)12-5-8-6-16-10(14)13-8/h6,9,12H,3-5,7H2,1-2H3,(H,13,14) |
| InChIKey | ZGVMFARFKKSVOA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one (CID 106379847) is 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one is CC1(C)CCSCC1NCc1csc(=O)[nH]1.
What is the InChIKey of 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one?
The InChIKey is ZGVMFARFKKSVOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS2/c1-11(2)3-4-15-7-9(11)12-5-8-6-16-10(14)13-8/h6,9,12H,3-5,7H2,1-2H3,(H,13,14).
What are the key properties of 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one?
4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one has a molecular weight of 258.41 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4,4-dimethylthian-3-yl)amino]methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 106379847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).