C9H16N2OS — CID 106379884
4-[(3-methylbutylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379884) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-[(3-methylbutylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(3-methylbutylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379884 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-[(3-methylbutylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(C)CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H16N2OS/c1-7(2)3-4-10-5-8-6-13-9(12)11-8/h6-7,10H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | RPCNPBBIFQHEMZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|