About 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one
4-[(decylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379907) has the molecular formula C14H26N2OS
and a molecular weight of 270.44 g/mol. Its IUPAC name is 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 106379907 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCCCCCCCCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C14H26N2OS/c1-2-3-4-5-6-7-8-9-10-15-11-13-12-18-14(17)16-13/h12,15H,2-11H2,1H3,(H,16,17) |
| InChIKey | KCXIMIJSFNVCST-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one (CID 106379907) is 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one is CCCCCCCCCCNCc1csc(=O)[nH]1.
What is the InChIKey of 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one?
The InChIKey is KCXIMIJSFNVCST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2OS/c1-2-3-4-5-6-7-8-9-10-15-11-13-12-18-14(17)16-13/h12,15H,2-11H2,1H3,(H,16,17).
What are the key properties of 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one?
4-[(decylamino)methyl]-3H-1,3-thiazol-2-one has a molecular weight of 270.44 g/mol, XLogP of 3.67, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(decylamino)methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 106379907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).