C9H14N2O2S — CID 106379936
4-[(oxolan-3-ylmethylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379936) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-[(oxolan-3-ylmethylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(oxolan-3-ylmethylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379936 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4-[(oxolan-3-ylmethylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNCC2CCOC2)cs1 |
| InChI | InChI=1S/C9H14N2O2S/c12-9-11-8(6-14-9)4-10-3-7-1-2-13-5-7/h6-7,10H,1-5H2,(H,11,12) |
| InChIKey | FWGHSLWVRPHWBW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |