About 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one
4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380479) has the molecular formula C9H16N2O3S
and a molecular weight of 232.30 g/mol. Its IUPAC name is 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 106380479 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | COC(OC)C(C)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H16N2O3S/c1-6(8(13-2)14-3)10-4-7-5-15-9(12)11-7/h5-6,8,10H,4H2,1-3H3,(H,11,12) |
| InChIKey | OFHFPSYTCNQBRK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one (CID 106380479) is 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one is COC(OC)C(C)NCc1csc(=O)[nH]1.
What is the InChIKey of 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one?
The InChIKey is OFHFPSYTCNQBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3S/c1-6(8(13-2)14-3)10-4-7-5-15-9(12)11-7/h5-6,8,10H,4H2,1-3H3,(H,11,12).
What are the key properties of 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one?
4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one has a molecular weight of 232.30 g/mol, XLogP of 0.53, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dimethoxypropan-2-ylamino)methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 106380479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).