C9H13ClN2O2S — CID 106380565
3-chloro-2,2-dimethyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 106380565) has the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 106380565 |
| Molecular Formula | C9H13ClN2O2S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | CC(C)(CCl)C(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H13ClN2O2S/c1-9(2,5-10)7(13)11-3-6-4-15-8(14)12-6/h4H,3,5H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | ODZBOCTWHQUGIN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|