About 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea
1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea (PubChem CID 106380590) has the molecular formula C6H9N3O2S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea |
| PubChem CID | 106380590 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea |
| SMILES | CNC(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C6H9N3O2S/c1-7-5(10)8-2-4-3-12-6(11)9-4/h3H,2H2,1H3,(H,9,11)(H2,7,8,10) |
| InChIKey | NPICTHQNMZSOHE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea?
The IUPAC name of 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea (CID 106380590) is 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea.
What is the SMILES notation for 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea?
The canonical SMILES for 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea is CNC(=O)NCc1csc(=O)[nH]1.
What is the InChIKey of 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea?
The InChIKey is NPICTHQNMZSOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2S/c1-7-5(10)8-2-4-3-12-6(11)9-4/h3H,2H2,1H3,(H,9,11)(H2,7,8,10).
What are the key properties of 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea?
1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea has a molecular weight of 187.22 g/mol, XLogP of -0.13, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea is sourced from PubChem (CID 106380590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).