About (2-oxo-3H-1,3-thiazol-4-yl)methylurea
(2-oxo-3H-1,3-thiazol-4-yl)methylurea (PubChem CID 106380591) has the molecular formula C5H7N3O2S
and a molecular weight of 173.20 g/mol. Its IUPAC name is (2-oxo-3H-1,3-thiazol-4-yl)methylurea.
Molecular Properties
| Compound Name | (2-oxo-3H-1,3-thiazol-4-yl)methylurea |
| PubChem CID | 106380591 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (2-oxo-3H-1,3-thiazol-4-yl)methylurea |
| SMILES | NC(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O2S/c6-4(9)7-1-3-2-11-5(10)8-3/h2H,1H2,(H,8,10)(H3,6,7,9) |
| InChIKey | LFYXKCPKHUHJCQ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-3H-1,3-thiazol-4-yl)methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-3H-1,3-thiazol-4-yl)methylurea?
The IUPAC name of (2-oxo-3H-1,3-thiazol-4-yl)methylurea (CID 106380591) is (2-oxo-3H-1,3-thiazol-4-yl)methylurea.
What is the SMILES notation for (2-oxo-3H-1,3-thiazol-4-yl)methylurea?
The canonical SMILES for (2-oxo-3H-1,3-thiazol-4-yl)methylurea is NC(=O)NCc1csc(=O)[nH]1.
What is the InChIKey of (2-oxo-3H-1,3-thiazol-4-yl)methylurea?
The InChIKey is LFYXKCPKHUHJCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2S/c6-4(9)7-1-3-2-11-5(10)8-3/h2H,1H2,(H,8,10)(H3,6,7,9).
What are the key properties of (2-oxo-3H-1,3-thiazol-4-yl)methylurea?
(2-oxo-3H-1,3-thiazol-4-yl)methylurea has a molecular weight of 173.20 g/mol, XLogP of -0.40, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-3H-1,3-thiazol-4-yl)methylurea is sourced from PubChem (CID 106380591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).