About 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea
1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea (PubChem CID 106380597) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea |
| PubChem CID | 106380597 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea |
| SMILES | CCNC(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O2S/c1-2-8-6(11)9-3-5-4-13-7(12)10-5/h4H,2-3H2,1H3,(H,10,12)(H2,8,9,11) |
| InChIKey | SGDYSCSTQYKTOQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea?
The IUPAC name of 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea (CID 106380597) is 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea.
What is the SMILES notation for 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea?
The canonical SMILES for 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea is CCNC(=O)NCc1csc(=O)[nH]1.
What is the InChIKey of 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea?
The InChIKey is SGDYSCSTQYKTOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-2-8-6(11)9-3-5-4-13-7(12)10-5/h4H,2-3H2,1H3,(H,10,12)(H2,8,9,11).
What are the key properties of 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea?
1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea has a molecular weight of 201.25 g/mol, XLogP of 0.26, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]urea is sourced from PubChem (CID 106380597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).