About ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate
ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate (PubChem CID 106380682) has the molecular formula C9H14N2O3S
and a molecular weight of 230.29 g/mol. Its IUPAC name is ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate |
| PubChem CID | 106380682 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate |
| SMILES | CCOC(=O)C(C)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O3S/c1-3-14-8(12)6(2)10-4-7-5-15-9(13)11-7/h5-6,10H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | WYNAKYJNMDZBJZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate?
The IUPAC name of ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate (CID 106380682) is ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate.
What is the SMILES notation for ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate?
The canonical SMILES for ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate is CCOC(=O)C(C)NCc1csc(=O)[nH]1.
What is the InChIKey of ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate?
The InChIKey is WYNAKYJNMDZBJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S/c1-3-14-8(12)6(2)10-4-7-5-15-9(13)11-7/h5-6,10H,3-4H2,1-2H3,(H,11,13).
What are the key properties of ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate?
ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate has a molecular weight of 230.29 g/mol, XLogP of 0.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoate is sourced from PubChem (CID 106380682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).