C15H28N2O3S — CID 106380697
4-[[(2-hydroxy-3-octoxypropyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380697) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is 4-[[(2-hydroxy-3-octoxypropyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2-hydroxy-3-octoxypropyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380697 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-[[(2-hydroxy-3-octoxypropyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCCCCCCOCC(O)CNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C15H28N2O3S/c1-2-3-4-5-6-7-8-20-11-14(18)10-16-9-13-12-21-15(19)17-13/h12,14,16,18H,2-11H2,1H3,(H,17,19) |
| InChIKey | SABYANMKIUWDBA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|