About methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate
methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate (PubChem CID 106380860) has the molecular formula C10H16N2O3S
and a molecular weight of 244.32 g/mol. Its IUPAC name is methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate.
Molecular Properties
| Compound Name | methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate |
| PubChem CID | 106380860 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate |
| SMILES | COC(=O)C(C)C(C)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H16N2O3S/c1-6(9(13)15-3)7(2)11-4-8-5-16-10(14)12-8/h5-7,11H,4H2,1-3H3,(H,12,14) |
| InChIKey | FERONNCXNDCRSC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate?
The IUPAC name of methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate (CID 106380860) is methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate.
What is the SMILES notation for methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate?
The canonical SMILES for methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate is COC(=O)C(C)C(C)NCc1csc(=O)[nH]1.
What is the InChIKey of methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate?
The InChIKey is FERONNCXNDCRSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3S/c1-6(9(13)15-3)7(2)11-4-8-5-16-10(14)12-8/h5-7,11H,4H2,1-3H3,(H,12,14).
What are the key properties of methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate?
methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate has a molecular weight of 244.32 g/mol, XLogP of 0.72, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate is sourced from PubChem (CID 106380860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).