C6H8N2O3S — CID 106380875
2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]acetic acid (PubChem CID 106380875) has the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. Its IUPAC name is 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]acetic acid.
| Compound Name | 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]acetic acid |
|---|---|
| PubChem CID | 106380875 |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]acetic acid |
| SMILES | O=C(O)CNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C6H8N2O3S/c9-5(10)2-7-1-4-3-12-6(11)8-4/h3,7H,1-2H2,(H,8,11)(H,9,10) |
| InChIKey | OEYQWZRGJQBIKW-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |