About 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one
4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381031) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 106381031 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CN[C@@H]2CCCC[C@H]2O)cs1 |
| InChI | InChI=1S/C10H16N2O2S/c13-9-4-2-1-3-8(9)11-5-7-6-15-10(14)12-7/h6,8-9,11,13H,1-5H2,(H,12,14)/t8-,9-/m1/s1 |
| InChIKey | WGAARZODKIRGBW-RKDXNWHRSA-N |
| XLogP | 0.83 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one (CID 106381031) is 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one is O=c1[nH]c(CN[C@@H]2CCCC[C@H]2O)cs1.
What is the InChIKey of 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one?
The InChIKey is WGAARZODKIRGBW-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H16N2O2S/c13-9-4-2-1-3-8(9)11-5-7-6-15-10(14)12-7/h6,8-9,11,13H,1-5H2,(H,12,14)/t8-,9-/m1/s1.
What are the key properties of 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one?
4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one has a molecular weight of 228.32 g/mol, XLogP of 0.83, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 106381031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).