About 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile
4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile (PubChem CID 106381049) has the molecular formula C8H11N3OS
and a molecular weight of 197.26 g/mol. Its IUPAC name is 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile.
Molecular Properties
| Compound Name | 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile |
| PubChem CID | 106381049 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile |
| SMILES | N#CCCCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3OS/c9-3-1-2-4-10-5-7-6-13-8(12)11-7/h6,10H,1-2,4-5H2,(H,11,12) |
| InChIKey | ZDVSVQBZHXKIGO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile?
The IUPAC name of 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile (CID 106381049) is 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile.
What is the SMILES notation for 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile?
The canonical SMILES for 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile is N#CCCCNCc1csc(=O)[nH]1.
What is the InChIKey of 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile?
The InChIKey is ZDVSVQBZHXKIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS/c9-3-1-2-4-10-5-7-6-13-8(12)11-7/h6,10H,1-2,4-5H2,(H,11,12).
What are the key properties of 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile?
4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile has a molecular weight of 197.26 g/mol, XLogP of 0.83, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanenitrile is sourced from PubChem (CID 106381049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).