About 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one
4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381088) has the molecular formula C13H24N2O3S
and a molecular weight of 288.41 g/mol. Its IUPAC name is 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 106381088 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(C)CC(C)OCC(O)CNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C13H24N2O3S/c1-9(2)4-10(3)18-7-12(16)6-14-5-11-8-19-13(17)15-11/h8-10,12,14,16H,4-7H2,1-3H3,(H,15,17) |
| InChIKey | ABBSWMHBPCKSRL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one (CID 106381088) is 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one is CC(C)CC(C)OCC(O)CNCc1csc(=O)[nH]1.
What is the InChIKey of 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one?
The InChIKey is ABBSWMHBPCKSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3S/c1-9(2)4-10(3)18-7-12(16)6-14-5-11-8-19-13(17)15-11/h8-10,12,14,16H,4-7H2,1-3H3,(H,15,17).
What are the key properties of 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one?
4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one has a molecular weight of 288.41 g/mol, XLogP of 1.34, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 106381088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).