C20H30O2 — CID 10638117
2-[(1R,3S,6E,10E,14R)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-3-yl]prop-2-enal (PubChem CID 10638117) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-[(1R,3S,6E,10E,14R)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-3-yl]prop-2-enal.
| Compound Name | 2-[(1R,3S,6E,10E,14R)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-3-yl]prop-2-enal |
|---|---|
| PubChem CID | 10638117 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-[(1R,3S,6E,10E,14R)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-3-yl]prop-2-enal |
| SMILES | C=C(C=O)[C@H]1CC/C(C)=C/CC/C(C)=C/CC[C@@]2(C)O[C@@H]2C1 |
| InChI | InChI=1S/C20H30O2/c1-15-7-5-8-16(2)10-11-18(17(3)14-21)13-19-20(4,22-19)12-6-9-15/h8-9,14,18-19H,3,5-7,10-13H2,1-2,4H3/b15-9+,16-8+/t18-,19+,20+/m0/s1 |
| InChIKey | CECHGFZFJNLAFP-ZNNUXXTPSA-N |
| XLogP | 5.15 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|