C10H19N3O2S — CID 106381729
4-[[(2-amino-5-methoxypentyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381729) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-[[(2-amino-5-methoxypentyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2-amino-5-methoxypentyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381729 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-[[(2-amino-5-methoxypentyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | COCCCC(N)CNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H19N3O2S/c1-15-4-2-3-8(11)5-12-6-9-7-16-10(14)13-9/h7-8,12H,2-6,11H2,1H3,(H,13,14) |
| InChIKey | NRFXMNGUBVIWAJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|