C11H13N3O5S — CID 106381948
2,3-dimethyl-4-oxo-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]but-2-enoic acid (PubChem CID 106381948) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]but-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-oxo-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106381948 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2,3-dimethyl-4-oxo-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]but-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H13N3O5S/c1-5(6(2)9(16)17)8(15)14-10(18)12-3-7-4-20-11(19)13-7/h4H,3H2,1-2H3,(H,13,19)(H,16,17)(H2,12,14,15,18) |
| InChIKey | WUNAPDMJGHWQAB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|