About methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate
methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate (PubChem CID 106382339) has the molecular formula C8H10N2O3S
and a molecular weight of 214.25 g/mol. Its IUPAC name is methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate |
| PubChem CID | 106382339 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H10N2O3S/c1-13-7(11)2-3-9-4-6-5-14-8(12)10-6/h2-3,5,9H,4H2,1H3,(H,10,12)/b3-2+ |
| InChIKey | FEHSAMWRPPHEON-NSCUHMNNSA-N |
| XLogP | 0.21 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate?
The IUPAC name of methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate (CID 106382339) is methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate?
The canonical SMILES for methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate is COC(=O)/C=C/NCc1csc(=O)[nH]1.
What is the InChIKey of methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate?
The InChIKey is FEHSAMWRPPHEON-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-13-7(11)2-3-9-4-6-5-14-8(12)10-6/h2-3,5,9H,4H2,1H3,(H,10,12)/b3-2+.
What are the key properties of methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate?
methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate has a molecular weight of 214.25 g/mol, XLogP of 0.21, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]prop-2-enoate is sourced from PubChem (CID 106382339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).