C6H6N4OS3 — CID 106382423
4-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382423) has the molecular formula C6H6N4OS3 and a molecular weight of 246.34 g/mol. Its IUPAC name is 4-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382423 |
| Molecular Formula | C6H6N4OS3 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | 4-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNc2n[nH]c(=S)s2)cs1 |
| InChI | InChI=1S/C6H6N4OS3/c11-5-8-3(2-13-5)1-7-4-9-10-6(12)14-4/h2H,1H2,(H,7,9)(H,8,11)(H,10,12) |
| InChIKey | ITEJVEQFXMJJML-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|