C7H8N4O2S2 — CID 106382431
4-[[3-(hydroxymethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382431) has the molecular formula C7H8N4O2S2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-[[3-(hydroxymethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[3-(hydroxymethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382431 |
| Molecular Formula | C7H8N4O2S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 4-[[3-(hydroxymethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(Cn2c(CO)n[nH]c2=S)cs1 |
| InChI | InChI=1S/C7H8N4O2S2/c12-2-5-9-10-6(14)11(5)1-4-3-15-7(13)8-4/h3,12H,1-2H2,(H,8,13)(H,10,14) |
| InChIKey | CFEMLDCETSACOF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|