C9H12N4OS2 — CID 106382435
4-[(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382435) has the molecular formula C9H12N4OS2 and a molecular weight of 256.36 g/mol. Its IUPAC name is 4-[(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382435 |
| Molecular Formula | C9H12N4OS2 |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-[(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCc1n[nH]c(=S)n1Cc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H12N4OS2/c1-2-3-7-11-12-8(15)13(7)4-6-5-16-9(14)10-6/h5H,2-4H2,1H3,(H,10,14)(H,12,15) |
| InChIKey | XGTXSAGRJVDBLH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|