About 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide
2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide (PubChem CID 106382695) has the molecular formula C6H10N2O4S2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide |
| PubChem CID | 106382695 |
| Molecular Formula | C6H10N2O4S2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide |
| SMILES | O=c1[nH]c(CNS(=O)(=O)CCO)cs1 |
| InChI | InChI=1S/C6H10N2O4S2/c9-1-2-14(11,12)7-3-5-4-13-6(10)8-5/h4,7,9H,1-3H2,(H,8,10) |
| InChIKey | FOKBNNUQHKSAOL-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide?
The IUPAC name of 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide (CID 106382695) is 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide.
What is the SMILES notation for 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide?
The canonical SMILES for 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide is O=c1[nH]c(CNS(=O)(=O)CCO)cs1.
What is the InChIKey of 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide?
The InChIKey is FOKBNNUQHKSAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O4S2/c9-1-2-14(11,12)7-3-5-4-13-6(10)8-5/h4,7,9H,1-3H2,(H,8,10).
What are the key properties of 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide?
2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide has a molecular weight of 238.29 g/mol, XLogP of -1.15, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide is sourced from PubChem (CID 106382695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).