About 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid
2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid (PubChem CID 106382765) has the molecular formula C9H13N3O4S
and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid |
| PubChem CID | 106382765 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H13N3O4S/c1-5(7(13)14)12(2)8(15)10-3-6-4-17-9(16)11-6/h4-5H,3H2,1-2H3,(H,10,15)(H,11,16)(H,13,14) |
| InChIKey | KJQKZGQYFYZXEM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid?
The IUPAC name of 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid (CID 106382765) is 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid.
What is the SMILES notation for 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid?
The canonical SMILES for 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid is CC(C(=O)O)N(C)C(=O)NCc1csc(=O)[nH]1.
What is the InChIKey of 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid?
The InChIKey is KJQKZGQYFYZXEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4S/c1-5(7(13)14)12(2)8(15)10-3-6-4-17-9(16)11-6/h4-5H,3H2,1-2H3,(H,10,15)(H,11,16)(H,13,14).
What are the key properties of 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid?
2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid has a molecular weight of 259.29 g/mol, XLogP of 0.05, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]amino]propanoic acid is sourced from PubChem (CID 106382765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).