About 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid
2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid (PubChem CID 106382774) has the molecular formula C8H11N3O5S
and a molecular weight of 261.26 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid |
| PubChem CID | 106382774 |
| Molecular Formula | C8H11N3O5S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid |
| SMILES | O=C(NCc1csc(=O)[nH]1)NCC(O)C(=O)O |
| InChI | InChI=1S/C8H11N3O5S/c12-5(6(13)14)2-10-7(15)9-1-4-3-17-8(16)11-4/h3,5,12H,1-2H2,(H,11,16)(H,13,14)(H2,9,10,15) |
| InChIKey | YUQJDDQLRMXTBS-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid?
The IUPAC name of 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid (CID 106382774) is 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid.
What is the SMILES notation for 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid?
The canonical SMILES for 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid is O=C(NCc1csc(=O)[nH]1)NCC(O)C(=O)O.
What is the InChIKey of 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid?
The InChIKey is YUQJDDQLRMXTBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O5S/c12-5(6(13)14)2-10-7(15)9-1-4-3-17-8(16)11-4/h3,5,12H,1-2H2,(H,11,16)(H,13,14)(H2,9,10,15).
What are the key properties of 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid?
2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid has a molecular weight of 261.26 g/mol, XLogP of -1.32, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]propanoic acid is sourced from PubChem (CID 106382774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).