C20H19NO2 — CID 10638299
(1R,10R,14R)-14-phenyl-16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-trien-12-one (PubChem CID 10638299) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (1R,10R,14R)-14-phenyl-16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-trien-12-one.
| Compound Name | (1R,10R,14R)-14-phenyl-16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-trien-12-one |
|---|---|
| PubChem CID | 10638299 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (1R,10R,14R)-14-phenyl-16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-trien-12-one |
| SMILES | O=C1C[C@H]2CCc3ccccc3[C@]23OC[C@@H](c2ccccc2)N13 |
| InChI | InChI=1S/C20H19NO2/c22-19-12-16-11-10-14-6-4-5-9-17(14)20(16)21(19)18(13-23-20)15-7-2-1-3-8-15/h1-9,16,18H,10-13H2/t16-,18+,20-/m1/s1 |
| InChIKey | PULDAXNJQPTFAQ-IMFGXOCKSA-N |
| XLogP | 3.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |