C6H7N5OS2 — CID 106383570
4-[(3-amino-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106383570) has the molecular formula C6H7N5OS2 and a molecular weight of 229.29 g/mol. Its IUPAC name is 4-[(3-amino-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(3-amino-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106383570 |
| Molecular Formula | C6H7N5OS2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 4-[(3-amino-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one |
| SMILES | Nc1n[nH]c(=S)n1Cc1csc(=O)[nH]1 |
| InChI | InChI=1S/C6H7N5OS2/c7-4-9-10-5(13)11(4)1-3-2-14-6(12)8-3/h2H,1H2,(H2,7,9)(H,8,12)(H,10,13) |
| InChIKey | UVLPILRKNUEXPD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|