C11H17N3OS — CID 106383629
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3H-1,3-thiazol-2-one (PubChem CID 106383629) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3H-1,3-thiazol-2-one.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106383629 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CN2CCN3CCCC3C2)cs1 |
| InChI | InChI=1S/C11H17N3OS/c15-11-12-9(8-16-11)6-13-4-5-14-3-1-2-10(14)7-13/h8,10H,1-7H2,(H,12,15) |
| InChIKey | XPHHOZWMEYQJGJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |