About 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide
4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide (PubChem CID 106383788) has the molecular formula C8H14N2O4S2
and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide.
Molecular Properties
| Compound Name | 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide |
| PubChem CID | 106383788 |
| Molecular Formula | C8H14N2O4S2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide |
| SMILES | O=c1[nH]c(CNS(=O)(=O)CCCCO)cs1 |
| InChI | InChI=1S/C8H14N2O4S2/c11-3-1-2-4-16(13,14)9-5-7-6-15-8(12)10-7/h6,9,11H,1-5H2,(H,10,12) |
| InChIKey | LNQKMJPQMOWBJI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide?
The IUPAC name of 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide (CID 106383788) is 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide.
What is the SMILES notation for 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide?
The canonical SMILES for 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide is O=c1[nH]c(CNS(=O)(=O)CCCCO)cs1.
What is the InChIKey of 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide?
The InChIKey is LNQKMJPQMOWBJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4S2/c11-3-1-2-4-16(13,14)9-5-7-6-15-8(12)10-7/h6,9,11H,1-5H2,(H,10,12).
What are the key properties of 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide?
4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide has a molecular weight of 266.34 g/mol, XLogP of -0.37, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide is sourced from PubChem (CID 106383788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).