C8H9ClN4O2S — CID 106384425
4-[[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106384425) has the molecular formula C8H9ClN4O2S and a molecular weight of 260.71 g/mol. Its IUPAC name is 4-[[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106384425 |
| Molecular Formula | C8H9ClN4O2S |
| Molecular Weight | 260.71 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 4-[[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(Cl)c1nnc(NCc2csc(=O)[nH]2)o1 |
| InChI | InChI=1S/C8H9ClN4O2S/c1-4(9)6-12-13-7(15-6)10-2-5-3-16-8(14)11-5/h3-4H,2H2,1H3,(H,10,13)(H,11,14) |
| InChIKey | WECZBHQERBYPLK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|