C10H15N5O2S — CID 106384431
4-[[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106384431) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-[[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106384431 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCNCc1nnc(NCc2csc(=O)[nH]2)o1 |
| InChI | InChI=1S/C10H15N5O2S/c1-2-3-11-5-8-14-15-9(17-8)12-4-7-6-18-10(16)13-7/h6,11H,2-5H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | NWHICUNCKQXBMW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|