C10H15N3O — CID 106384829
2-amino-N-(1H-pyrrol-3-ylmethyl)pent-4-enamide (PubChem CID 106384829) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-amino-N-(1H-pyrrol-3-ylmethyl)pent-4-enamide.
| Compound Name | 2-amino-N-(1H-pyrrol-3-ylmethyl)pent-4-enamide |
|---|---|
| PubChem CID | 106384829 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-amino-N-(1H-pyrrol-3-ylmethyl)pent-4-enamide |
| SMILES | C=CCC(N)C(=O)NCc1cc[nH]c1 |
| InChI | InChI=1S/C10H15N3O/c1-2-3-9(11)10(14)13-7-8-4-5-12-6-8/h2,4-6,9,12H,1,3,7,11H2,(H,13,14) |
| InChIKey | NILDZKMFKJXCOL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|